| The chemistry of organic-inorganic coordination polymers has recentlybecome area of increasing interest. Self-assembly of organic ligands and inorganicmetal ions is one of the most efficient and widely used approaches for theconstruction of organic-inorganic composite materials. In this dissertation, a seriesof nanosized bent 1, 3, 4-Oxadiazole-bridging ligands with phenylamine orpyridyl as terminal groups have been designed and synthesized;the coordinationchemistry of bent 1, 3, 4-Oxadiazole-bridging ligands with acetylenylphenyl,pyridine-N-oxide or phenylamine as terminal groups and new double schiff-baseligands with thiazole or furan as terminal groups with various metals were studied;totally 38 new coordination polymers and supramolecular complexes weresynthesized and elucidated by a number of analytical techniques, such as IR, HNMR, elemental analysis, ESMS, TGA, powder X-ray diffraction andsingle-crystal X-ray diffraction;the luminescent properties, host-guest chemistryand electrical conductive properties of the representatives were studied.1. The coordination chemistry based on bent 1, 3, 4-Oxadiazole-bridging ligandsand Ag(I) saltsThe coordination chemistry of bent 1, 3, 4-Oxadiazole-bridging ligands withacetylenylphenyl, pyridine-N-oxide or phenylamine as terminal groups L1,L12, L14, L16 -L17 with AgOTf, AgBF4, AgClO4 and AgNO3 has beeninvestigated. 8 new coordination polymers [Ag(L1)](SO3CF3) (1),[Ag(L1)(H2O)0.5]BF4·0.5H2O (2), {[Ag2(L1)(H2O)](ClO4)2}·(o-xylene) (3),Ag(L12)NO3 (4), Ag(L14)SO3CF3 (5), Ag(L14)NO3 (6), [Ag(L16)]·ClO4 (7)and Ag2(L17)(NO3)2(H2O) (8) were synthesized and characterized. Thehost-guest chemistry of 3, electrical conductive properties of 1 and 3,luminescent properties of compound 1 -3 were investigated.2. The coordination chemistry of bent 1, 3, 4-Oxadiazole-bridging ligands withpyridine-N-oxide as terminal groups and other transition or thulium metalsTotally 13 new coordination polymers and supramolecular complexes,namely [Cd0.5(L12)(H2O)](NO3) (9), Ni(L12)2(H2O)2(CH3CN)2(ClO4)2 (10),Hg(L12)Cl2 (11), Zn(L12)Cl2 (12), [Cu(L12)](SCN)2(CH3CN) (13),[Cu(L12)2(CH3CN)](ClO4)2 (14), Cd(L12)2(SCN)2 (15),Co(L12)2(H2O)2(CH3CN)2(NO3)2 (16), [Cu(L15)(H2O)]Cl2 (17),Ce(L12)(NO3)3(H2O)2(CH3CN) (18), La(L12)(NO3)3(H2O)2(CH3CN) (19),[Eu(L12)3(H2O)5](ClO4)3 (20), [Eu(L14)(H2O)4(SCN)3]?H2O (21), and anovel supramolecular complexes containing two different metal centersCdCe2(L12)4(NO3)8(H2O)6?2(CH3OH) (22) were generated by thecombination of L12, L14 -L15 and Cd(NO3)2, Ni(ClO4)2, HgCl2, ZnCl2,Cu(ClO4)2, Cu(SCN)2, Cd(SCN)2, Co(NO3)2, CuCl2, Ce(NO3)3, La(NO3)3,Eu(ClO4)3 and Eu(SCN)3 seperately. The luminescent properties ofcompound 18 -21 were investigated.3. The coordination chemistry of Schiff-base ligands and transition metalsReactions of novel Schiff-base ligands with thiazole or furan as terminalgroups L18 -L24 with AgSbF6, AgSO3CF3, AgH2PO4, AgNO3, AgPF6,AgBF4, HgI2, HgBr2 and HgCl2 afforded 16 new coordination polymers andsupramolecular complexes [Ag(L18)](SbF6)?(THF) (23),[Ag(L18)](SbF6)?(C6H6) (24), [Ag(L18)](SbF6)?(CH2Cl2)(25),[Ag(L18)]SO3CF3 (26), [Ag2(L18)](H2PO4)2 (27), [Ag2(L18)](NO3)2 (28),[Ag(L19)]NO3 (29), Cu(L19)Cl2 (30), [Ag2(L20)3](PF6)2 (31),[Ag2(L20)3](SbF6)2 (32), Ag(L21)SO3CF3 (33), [Ag(L23)]]BF4 (34),Hg(L22)I2 (35), Hg(L22)Br2 (36), [Hg(L24)]Cl2(37) and [Hg(L24)]Br2 (38).The host-guest chemistry of 24, electrical conductive properties of 23 and 26,luminescent properties of compound 23, 26 and 28 were investigated.The results reported herein demonstrate that the use of the bent 1, 3,4-Oxadiazole-bridging and Schiff-base organic spacers as precursors to bindtransition metal ions, is in fact a new approach for the formation of novelsupramolecular networks with interesting physical properties. |